C19H26O — CID 11242698
(10R,12S)-8,11,11,15-tetramethyltetracyclo[7.6.0.02,6.010,12]pentadeca-2(6),14-dien-7-one (PubChem CID 11242698) has the molecular formula C19H26O and a molecular weight of 270.42 g/mol. Its IUPAC name is (10R,12S)-8,11,11,15-tetramethyltetracyclo[7.6.0.02,6.010,12]pentadeca-2(6),14-dien-7-one.
| Compound Name | (10R,12S)-8,11,11,15-tetramethyltetracyclo[7.6.0.02,6.010,12]pentadeca-2(6),14-dien-7-one |
|---|---|
| PubChem CID | 11242698 |
| Molecular Formula | C19H26O |
| Molecular Weight | 270.42 g/mol |
| Exact Mass | 270.20 |
| IUPAC Name | (10R,12S)-8,11,11,15-tetramethyltetracyclo[7.6.0.02,6.010,12]pentadeca-2(6),14-dien-7-one |
| SMILES | CC1=CC[C@H]2[C@@H](C3C(C)C(=O)C4=C(CCC4)C13)C2(C)C |
| InChI | InChI=1S/C19H26O/c1-10-8-9-14-17(19(14,3)4)16-11(2)18(20)13-7-5-6-12(13)15(10)16/h8,11,14-17H,5-7,9H2,1-4H3/t11?,14-,15?,16?,17-/m0/s1 |
| InChIKey | XZXQGMRDDNUOLU-KJNWJWNXSA-N |
| XLogP | 4.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.42 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|