C12H16O — CID 130038331
6,8-dimethyltricyclo[4.4.0.02,7]dec-8-en-3-one (PubChem CID 130038331) has the molecular formula C12H16O and a molecular weight of 176.26 g/mol. Its IUPAC name is 6,8-dimethyltricyclo[4.4.0.02,7]dec-8-en-3-one.
| Compound Name | 6,8-dimethyltricyclo[4.4.0.02,7]dec-8-en-3-one |
|---|---|
| PubChem CID | 130038331 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 6,8-dimethyltricyclo[4.4.0.02,7]dec-8-en-3-one |
| SMILES | CC1=CCC2C3C(=O)CCC2(C)C13 |
| InChI | InChI=1S/C12H16O/c1-7-3-4-8-10-9(13)5-6-12(8,2)11(7)10/h3,8,10-11H,4-6H2,1-2H3 |
| InChIKey | SUQKWTHDSXZDIP-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|