C26H40O2 — CID 159762121
4,4,6-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one;4,4,7-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one (PubChem CID 159762121) has the molecular formula C26H40O2 and a molecular weight of 384.60 g/mol. Its IUPAC name is 4,4,6-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one;4,4,7-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one.
| Compound Name | 4,4,6-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one;4,4,7-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one |
|---|---|
| PubChem CID | 159762121 |
| Molecular Formula | C26H40O2 |
| Molecular Weight | 384.60 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 4,4,6-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one;4,4,7-trimethyl-2,3,4a,5,8,8a-hexahydronaphthalen-1-one |
| SMILES | CC1=CCC2C(=O)CCC(C)(C)C2C1.CC1=CCC2C(C1)C(=O)CCC2(C)C |
| InChI | InChI=1S/2C13H20O/c1-9-4-5-11-10(8-9)12(14)6-7-13(11,2)3;1-9-4-5-10-11(8-9)13(2,3)7-6-12(10)14/h2*4,10-11H,5-8H2,1-3H3 |
| InChIKey | NFAIUFZDZMNDLA-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.60 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|