C13H13N3O2 — CID 799576
(3aS,7aR)-5-methyl-2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione (PubChem CID 799576) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is (3aS,7aR)-5-methyl-2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione.
| Compound Name | (3aS,7aR)-5-methyl-2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 799576 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | (3aS,7aR)-5-methyl-2-pyrimidin-2-yl-3a,4,7,7a-tetrahydroisoindole-1,3-dione |
| SMILES | CC1=CC[C@H]2C(=O)N(c3ncccn3)C(=O)[C@H]2C1 |
| InChI | InChI=1S/C13H13N3O2/c1-8-3-4-9-10(7-8)12(18)16(11(9)17)13-14-5-2-6-15-13/h2-3,5-6,9-10H,4,7H2,1H3/t9-,10+/m1/s1 |
| InChIKey | TYZQUGZRFPQBJZ-ZJUUUORDSA-N |
| XLogP | 1.32 |
| TPSA | 63.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|