C10H10O3 — CID 101096225
5-methyl-3a,4,7,7a-tetrahydroindene-1,2,3-trione (PubChem CID 101096225) has the molecular formula C10H10O3 and a molecular weight of 178.19 g/mol. Its IUPAC name is 5-methyl-3a,4,7,7a-tetrahydroindene-1,2,3-trione.
| Compound Name | 5-methyl-3a,4,7,7a-tetrahydroindene-1,2,3-trione |
|---|---|
| PubChem CID | 101096225 |
| Molecular Formula | C10H10O3 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.06 |
| IUPAC Name | 5-methyl-3a,4,7,7a-tetrahydroindene-1,2,3-trione |
| SMILES | CC1=CCC2C(=O)C(=O)C(=O)C2C1 |
| InChI | InChI=1S/C10H10O3/c1-5-2-3-6-7(4-5)9(12)10(13)8(6)11/h2,6-7H,3-4H2,1H3 |
| InChIKey | YFZOYIHMHYLLAX-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|