C20H28O — CID 156642763
(8aR)-6,9,9-trimethyl-2-propyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol (PubChem CID 156642763) has the molecular formula C20H28O and a molecular weight of 284.44 g/mol. Its IUPAC name is (8aR)-6,9,9-trimethyl-2-propyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol.
| Compound Name | (8aR)-6,9,9-trimethyl-2-propyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol |
|---|---|
| PubChem CID | 156642763 |
| Molecular Formula | C20H28O |
| Molecular Weight | 284.44 g/mol |
| Exact Mass | 284.21 |
| IUPAC Name | (8aR)-6,9,9-trimethyl-2-propyl-5,8,8a,10-tetrahydro-4bH-phenanthren-4-ol |
| SMILES | CCCc1cc(O)c2c(c1)CC(C)(C)[C@@H]1CC=C(C)CC21 |
| InChI | InChI=1S/C20H28O/c1-5-6-14-10-15-12-20(3,4)17-8-7-13(2)9-16(17)19(15)18(21)11-14/h7,10-11,16-17,21H,5-6,8-9,12H2,1-4H3/t16?,17-/m1/s1 |
| InChIKey | WEAIURONCMGJJN-ZYMOGRSISA-N |
| XLogP | 5.37 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.44 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|