C10H14O2 — CID 162818023
(1S,6R,7R)-3,7-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid (PubChem CID 162818023) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (1S,6R,7R)-3,7-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid.
| Compound Name | (1S,6R,7R)-3,7-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid |
|---|---|
| PubChem CID | 162818023 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (1S,6R,7R)-3,7-dimethylbicyclo[4.1.0]hept-3-ene-7-carboxylic acid |
| SMILES | CC1=CC[C@@H]2[C@H](C1)[C@]2(C)C(=O)O |
| InChI | InChI=1S/C10H14O2/c1-6-3-4-7-8(5-6)10(7,2)9(11)12/h3,7-8H,4-5H2,1-2H3,(H,11,12)/t7-,8+,10-/m1/s1 |
| InChIKey | IWWQJAJFNWJUSK-KHQFGBGNSA-N |
| XLogP | 2.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|