C12H18O — CID 134992312
(3aS,7S,7aR)-3a,6,7-trimethyl-3,4,7,7a-tetrahydro-2H-inden-1-one (PubChem CID 134992312) has the molecular formula C12H18O and a molecular weight of 178.28 g/mol. Its IUPAC name is (3aS,7S,7aR)-3a,6,7-trimethyl-3,4,7,7a-tetrahydro-2H-inden-1-one.
| Compound Name | (3aS,7S,7aR)-3a,6,7-trimethyl-3,4,7,7a-tetrahydro-2H-inden-1-one |
|---|---|
| PubChem CID | 134992312 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (3aS,7S,7aR)-3a,6,7-trimethyl-3,4,7,7a-tetrahydro-2H-inden-1-one |
| SMILES | CC1=CC[C@]2(C)CCC(=O)[C@@H]2[C@@H]1C |
| InChI | InChI=1S/C12H18O/c1-8-4-6-12(3)7-5-10(13)11(12)9(8)2/h4,9,11H,5-7H2,1-3H3/t9-,11+,12-/m1/s1 |
| InChIKey | OBAUNILMZXRUJV-ADEWGFFLSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|