C8H12O2 — CID 573500
6-(hydroxymethyl)-5-methylbicyclo[3.1.0]hexan-2-one (PubChem CID 573500) has the molecular formula C8H12O2 and a molecular weight of 140.18 g/mol. Its IUPAC name is 6-(hydroxymethyl)-5-methylbicyclo[3.1.0]hexan-2-one.
| Compound Name | 6-(hydroxymethyl)-5-methylbicyclo[3.1.0]hexan-2-one |
|---|---|
| PubChem CID | 573500 |
| Molecular Formula | C8H12O2 |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.08 |
| IUPAC Name | 6-(hydroxymethyl)-5-methylbicyclo[3.1.0]hexan-2-one |
| SMILES | CC12CCC(=O)C1C2CO |
| InChI | InChI=1S/C8H12O2/c1-8-3-2-6(10)7(8)5(8)4-9/h5,7,9H,2-4H2,1H3 |
| InChIKey | SOGDMXGDKRLFOF-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |