C9H12O2 — CID 130037609
7-(hydroxymethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one (PubChem CID 130037609) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 7-(hydroxymethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one.
| Compound Name | 7-(hydroxymethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one |
|---|---|
| PubChem CID | 130037609 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 7-(hydroxymethyl)-1-methylbicyclo[2.2.1]hept-5-en-2-one |
| SMILES | CC12C=CC(CC1=O)C2CO |
| InChI | InChI=1S/C9H12O2/c1-9-3-2-6(4-8(9)11)7(9)5-10/h2-3,6-7,10H,4-5H2,1H3 |
| InChIKey | HMQAESDORJZTCV-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|