C8H14O4 — CID 155392917
2-hydroxy-3-(2-hydroxyethoxy)-3-methylcyclopentan-1-one (PubChem CID 155392917) has the molecular formula C8H14O4 and a molecular weight of 174.20 g/mol. Its IUPAC name is 2-hydroxy-3-(2-hydroxyethoxy)-3-methylcyclopentan-1-one.
| Compound Name | 2-hydroxy-3-(2-hydroxyethoxy)-3-methylcyclopentan-1-one |
|---|---|
| PubChem CID | 155392917 |
| Molecular Formula | C8H14O4 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-hydroxy-3-(2-hydroxyethoxy)-3-methylcyclopentan-1-one |
| SMILES | CC1(OCCO)CCC(=O)C1O |
| InChI | InChI=1S/C8H14O4/c1-8(12-5-4-9)3-2-6(10)7(8)11/h7,9,11H,2-5H2,1H3 |
| InChIKey | SKIYAAVFKUGAFR-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |