C18H29N3O3 — CID 101063444
(3'aR,7'S,7'aS)-7'-(2-azidoethyl)-3'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,6'-2,3,4,5,7,7a-hexahydroindene]-1'-one (PubChem CID 101063444) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is (3'aR,7'S,7'aS)-7'-(2-azidoethyl)-3'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,6'-2,3,4,5,7,7a-hexahydroindene]-1'-one.
| Compound Name | (3'aR,7'S,7'aS)-7'-(2-azidoethyl)-3'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,6'-2,3,4,5,7,7a-hexahydroindene]-1'-one |
|---|---|
| PubChem CID | 101063444 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | (3'aR,7'S,7'aS)-7'-(2-azidoethyl)-3'a-ethyl-5,5-dimethylspiro[1,3-dioxane-2,6'-2,3,4,5,7,7a-hexahydroindene]-1'-one |
| SMILES | CC[C@]12CCC(=O)[C@H]1[C@H](CCN=[N+]=[N-])C1(CC2)OCC(C)(C)CO1 |
| InChI | InChI=1S/C18H29N3O3/c1-4-17-7-5-14(22)15(17)13(6-10-20-21-19)18(9-8-17)23-11-16(2,3)12-24-18/h13,15H,4-12H2,1-3H3/t13-,15+,17+/m0/s1 |
| InChIKey | UTDPNYTZQWOCTD-YSVLISHTSA-N |
| XLogP | 4.24 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|