C17H27N3O3 — CID 91193622
1-(4-azidobutyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methylidenecyclohexane-1-carbaldehyde (PubChem CID 91193622) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 1-(4-azidobutyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methylidenecyclohexane-1-carbaldehyde.
| Compound Name | 1-(4-azidobutyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methylidenecyclohexane-1-carbaldehyde |
|---|---|
| PubChem CID | 91193622 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 1-(4-azidobutyl)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-methylidenecyclohexane-1-carbaldehyde |
| SMILES | C=C1CCC(C=O)(CCCCN=[N+]=[N-])C(C2COC(C)(C)O2)C1 |
| InChI | InChI=1S/C17H27N3O3/c1-13-6-8-17(12-21,7-4-5-9-19-20-18)14(10-13)15-11-22-16(2,3)23-15/h12,14-15H,1,4-11H2,2-3H3 |
| InChIKey | FVVHTIXNJSBTAE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 84.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|