C20H31N3O5 — CID 11234778
(3S,4R)-4-acetyl-4-[(2S,3R)-4-azido-2,3-dimethylbutyl]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexene-1-carboxylic acid (PubChem CID 11234778) has the molecular formula C20H31N3O5 and a molecular weight of 393.48 g/mol. Its IUPAC name is (3S,4R)-4-acetyl-4-[(2S,3R)-4-azido-2,3-dimethylbutyl]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexene-1-carboxylic acid.
| Compound Name | (3S,4R)-4-acetyl-4-[(2S,3R)-4-azido-2,3-dimethylbutyl]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexene-1-carboxylic acid |
|---|---|
| PubChem CID | 11234778 |
| Molecular Formula | C20H31N3O5 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.23 |
| IUPAC Name | (3S,4R)-4-acetyl-4-[(2S,3R)-4-azido-2,3-dimethylbutyl]-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]cyclohexene-1-carboxylic acid |
| SMILES | CC(=O)[C@@]1(C[C@H](C)[C@@H](C)CN=[N+]=[N-])CCC(C(=O)O)=C[C@@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C20H31N3O5/c1-12(13(2)10-22-23-21)9-20(14(3)24)7-6-15(18(25)26)8-16(20)17-11-27-19(4,5)28-17/h8,12-13,16-17H,6-7,9-11H2,1-5H3,(H,25,26)/t12-,13-,16+,17+,20-/m0/s1 |
| InChIKey | ZSTDJFROJSAZSF-XAAHCIJYSA-N |
| XLogP | 4.11 |
| TPSA | 121.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|