C18H28N6O7 — CID 162409844
1-[4-[[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxymethyl]triazol-1-yl]-3-azidopropan-2-ol (PubChem CID 162409844) has the molecular formula C18H28N6O7 and a molecular weight of 440.46 g/mol. Its IUPAC name is 1-[4-[[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxymethyl]triazol-1-yl]-3-azidopropan-2-ol.
| Compound Name | 1-[4-[[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxymethyl]triazol-1-yl]-3-azidopropan-2-ol |
|---|---|
| PubChem CID | 162409844 |
| Molecular Formula | C18H28N6O7 |
| Molecular Weight | 440.46 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | 1-[4-[[(3aS,4R,6R,6aS)-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-4-yl]oxymethyl]triazol-1-yl]-3-azidopropan-2-ol |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@H](OCc1cn(CC(O)CN=[N+]=[N-])nn1)O[C@@H]2[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H28N6O7/c1-17(2)27-9-12(29-17)13-14-15(31-18(3,4)30-14)16(28-13)26-8-10-6-24(23-21-10)7-11(25)5-20-22-19/h6,11-16,25H,5,7-9H2,1-4H3/t11?,12-,13-,14+,15+,16-/m1/s1 |
| InChIKey | YZVDZFABEFQNDD-YOPVGWMHSA-N |
| XLogP | 0.86 |
| TPSA | 155.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.46 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|