C13H23N3O6 — CID 72701015
(4S,5R,6S)-4-[(1S)-1-azido-2-hydroxyethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol (PubChem CID 72701015) has the molecular formula C13H23N3O6 and a molecular weight of 317.34 g/mol. Its IUPAC name is (4S,5R,6S)-4-[(1S)-1-azido-2-hydroxyethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol.
| Compound Name | (4S,5R,6S)-4-[(1S)-1-azido-2-hydroxyethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol |
|---|---|
| PubChem CID | 72701015 |
| Molecular Formula | C13H23N3O6 |
| Molecular Weight | 317.34 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (4S,5R,6S)-4-[(1S)-1-azido-2-hydroxyethyl]-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-2,2-dimethyl-1,3-dioxan-5-ol |
| SMILES | CC1(C)O[C@@H]([C@H](CO)N=[N+]=[N-])[C@@H](O)[C@@H]([C@H]2COC(C)(C)O2)O1 |
| InChI | InChI=1S/C13H23N3O6/c1-12(2)19-6-8(20-12)11-9(18)10(7(5-17)15-16-14)21-13(3,4)22-11/h7-11,17-18H,5-6H2,1-4H3/t7-,8+,9+,10-,11+/m0/s1 |
| InChIKey | TWNFPBRMHWVBHG-UNQZSWDGSA-N |
| XLogP | 0.69 |
| TPSA | 126.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.34 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|