C11H16N6O7 — CID 174067137
(2S,5R)-2,3-diazido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydroxyoxane-2-carboxylic acid (PubChem CID 174067137) has the molecular formula C11H16N6O7 and a molecular weight of 344.28 g/mol. Its IUPAC name is (2S,5R)-2,3-diazido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydroxyoxane-2-carboxylic acid.
| Compound Name | (2S,5R)-2,3-diazido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydroxyoxane-2-carboxylic acid |
|---|---|
| PubChem CID | 174067137 |
| Molecular Formula | C11H16N6O7 |
| Molecular Weight | 344.28 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | (2S,5R)-2,3-diazido-6-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-4,5-dihydroxyoxane-2-carboxylic acid |
| SMILES | CC1(C)OC[C@H](C2O[C@](N=[N+]=[N-])(C(=O)O)C(N=[N+]=[N-])C(O)[C@H]2O)O1 |
| InChI | InChI=1S/C11H16N6O7/c1-10(2)22-3-4(23-10)7-5(18)6(19)8(14-16-12)11(24-7,9(20)21)15-17-13/h4-8,18-19H,3H2,1-2H3,(H,20,21)/t4-,5-,6?,7?,8?,11+/m1/s1 |
| InChIKey | SARIDPRMMHUFDL-SEOYJHGYSA-N |
| XLogP | 0.03 |
| TPSA | 202.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.28 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|