C20H26O2 — CID 102192689
(4R,8S)-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione (PubChem CID 102192689) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (4R,8S)-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione.
| Compound Name | (4R,8S)-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione |
|---|---|
| PubChem CID | 102192689 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (4R,8S)-4,8,11,11-tetramethyl-15-methylidenetetracyclo[7.6.0.02,6.010,12]pentadec-2(6)-ene-3,7-dione |
| SMILES | C=C1CCC2C(C3C(C)C(=O)C4=C(C(=O)[C@H](C)C4)C13)C2(C)C |
| InChI | InChI=1S/C20H26O2/c1-9-6-7-13-17(20(13,4)5)15-11(3)19(22)12-8-10(2)18(21)16(12)14(9)15/h10-11,13-15,17H,1,6-8H2,2-5H3/t10-,11?,13?,14?,15?,17?/m1/s1 |
| InChIKey | VYBBQJWRIBGXEQ-HCTXTAMUSA-N |
| XLogP | 3.97 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|