C20H28O5 — CID 139292004
(1S,2R,5S,6S,9R,10R,11R,13S)-2,6,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-ene-4,8-dione (PubChem CID 139292004) has the molecular formula C20H28O5 and a molecular weight of 348.44 g/mol. Its IUPAC name is (1S,2R,5S,6S,9R,10R,11R,13S)-2,6,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-ene-4,8-dione.
| Compound Name | (1S,2R,5S,6S,9R,10R,11R,13S)-2,6,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-ene-4,8-dione |
|---|---|
| PubChem CID | 139292004 |
| Molecular Formula | C20H28O5 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.19 |
| IUPAC Name | (1S,2R,5S,6S,9R,10R,11R,13S)-2,6,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-ene-4,8-dione |
| SMILES | C[C@@H]1C(=O)C2=C(C(=O)[C@@]3(C)[C@H](O)[C@@H]4[C@H](CC[C@]3(C)[C@H]2O)C4(C)C)[C@H]1O |
| InChI | InChI=1S/C20H28O5/c1-8-13(21)10-11(14(8)22)16(24)20(5)17(25)12-9(18(12,2)3)6-7-19(20,4)15(10)23/h8-9,12,14-15,17,22-23,25H,6-7H2,1-5H3/t8-,9+,12+,14+,15+,17-,19-,20+/m1/s1 |
| InChIKey | PDVBXFORJHQVEI-PYXLCIGFSA-N |
| XLogP | 1.25 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |