C20H30O4 — CID 139051906
(1S,2R,4R,5S,9R,10R,11R,13S)-2,4,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-en-8-one (PubChem CID 139051906) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is (1S,2R,4R,5S,9R,10R,11R,13S)-2,4,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-en-8-one.
| Compound Name | (1S,2R,4R,5S,9R,10R,11R,13S)-2,4,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-en-8-one |
|---|---|
| PubChem CID | 139051906 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | (1S,2R,4R,5S,9R,10R,11R,13S)-2,4,10-trihydroxy-1,5,9,12,12-pentamethyltetracyclo[7.6.0.03,7.011,13]pentadec-3(7)-en-8-one |
| SMILES | C[C@H]1CC2=C([C@@H]1O)[C@H](O)[C@@]1(C)CC[C@H]3[C@@H]([C@@H](O)[C@]1(C)C2=O)C3(C)C |
| InChI | InChI=1S/C20H30O4/c1-9-8-10-12(14(9)21)16(23)19(4)7-6-11-13(18(11,2)3)17(24)20(19,5)15(10)22/h9,11,13-14,16-17,21,23-24H,6-8H2,1-5H3/t9-,11-,13-,14+,16-,17+,19+,20-/m0/s1 |
| InChIKey | NNSBPFCEWFSYFB-QORZALBUSA-N |
| XLogP | 2.07 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |