C29H38O6 — CID 162953159
(2,4,7-trihydroxy-1,5,9,12,12-pentamethyl-8-oxo-10-tetracyclo[7.6.0.03,7.011,13]pentadecanyl) 3-phenylprop-2-enoate (PubChem CID 162953159) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is (2,4,7-trihydroxy-1,5,9,12,12-pentamethyl-8-oxo-10-tetracyclo[7.6.0.03,7.011,13]pentadecanyl) 3-phenylprop-2-enoate.
| Compound Name | (2,4,7-trihydroxy-1,5,9,12,12-pentamethyl-8-oxo-10-tetracyclo[7.6.0.03,7.011,13]pentadecanyl) 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162953159 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | (2,4,7-trihydroxy-1,5,9,12,12-pentamethyl-8-oxo-10-tetracyclo[7.6.0.03,7.011,13]pentadecanyl) 3-phenylprop-2-enoate |
| SMILES | CC1CC2(O)C(=O)C3(C)C(OC(=O)C=Cc4ccccc4)C4C(CCC3(C)C(O)C2C1O)C4(C)C |
| InChI | InChI=1S/C29H38O6/c1-16-15-29(34)21(22(16)31)23(32)27(4)14-13-18-20(26(18,2)3)24(28(27,5)25(29)33)35-19(30)12-11-17-9-7-6-8-10-17/h6-12,16,18,20-24,31-32,34H,13-15H2,1-5H3 |
| InChIKey | ZFZHLCYJAAZLGY-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|