C27H36O6 — CID 102359568
[(1R,2R,4S,7R,8R,9S,10S,11S,13R,14S,15R)-8,13,14-trihydroxy-3,3,7,11,15-pentamethyl-16-oxapentacyclo[11.2.1.02,4.07,15.09,14]hexadecan-10-yl] benzoate (PubChem CID 102359568) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is [(1R,2R,4S,7R,8R,9S,10S,11S,13R,14S,15R)-8,13,14-trihydroxy-3,3,7,11,15-pentamethyl-16-oxapentacyclo[11.2.1.02,4.07,15.09,14]hexadecan-10-yl] benzoate.
| Compound Name | [(1R,2R,4S,7R,8R,9S,10S,11S,13R,14S,15R)-8,13,14-trihydroxy-3,3,7,11,15-pentamethyl-16-oxapentacyclo[11.2.1.02,4.07,15.09,14]hexadecan-10-yl] benzoate |
|---|---|
| PubChem CID | 102359568 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | [(1R,2R,4S,7R,8R,9S,10S,11S,13R,14S,15R)-8,13,14-trihydroxy-3,3,7,11,15-pentamethyl-16-oxapentacyclo[11.2.1.02,4.07,15.09,14]hexadecan-10-yl] benzoate |
| SMILES | C[C@H]1C[C@@]2(O)O[C@@H]3[C@@H]4[C@H](CC[C@@]5(C)[C@H](O)[C@@H]([C@H]1OC(=O)c1ccccc1)[C@]2(O)[C@@]35C)C4(C)C |
| InChI | InChI=1S/C27H36O6/c1-14-13-26(30)27(31)18(19(14)32-22(29)15-9-7-6-8-10-15)20(28)24(4)12-11-16-17(23(16,2)3)21(33-26)25(24,27)5/h6-10,14,16-21,28,30-31H,11-13H2,1-5H3/t14-,16-,17-,18+,19-,20+,21+,24-,25-,26+,27-/m0/s1 |
| InChIKey | QXXQARHTEFIUCN-KGGVIXQZSA-N |
| XLogP | 3.14 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |