C29H36O7 — CID 162812542
[(4aR,5R,6R,6aS,7R,10aS,11aR,11bR)-4a,6,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5-yl] 3-phenylprop-2-enoate (PubChem CID 162812542) has the molecular formula C29H36O7 and a molecular weight of 496.60 g/mol. Its IUPAC name is [(4aR,5R,6R,6aS,7R,10aS,11aR,11bR)-4a,6,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5-yl] 3-phenylprop-2-enoate.
| Compound Name | [(4aR,5R,6R,6aS,7R,10aS,11aR,11bR)-4a,6,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5-yl] 3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 162812542 |
| Molecular Formula | C29H36O7 |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | [(4aR,5R,6R,6aS,7R,10aS,11aR,11bR)-4a,6,10a-trihydroxy-4,4,7,11b-tetramethyl-9-oxo-2,3,5,6,6a,7,11,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-5-yl] 3-phenylprop-2-enoate |
| SMILES | C[C@H]1C2=CC(=O)O[C@@]2(O)C[C@@H]2[C@H]1[C@@H](O)[C@@H](OC(=O)C=Cc1ccccc1)[C@@]1(O)C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C29H36O7/c1-17-19-15-22(31)36-28(19,33)16-20-23(17)24(32)25(29(34)26(2,3)13-8-14-27(20,29)4)35-21(30)12-11-18-9-6-5-7-10-18/h5-7,9-12,15,17,20,23-25,32-34H,8,13-14,16H2,1-4H3/t17-,20+,23-,24+,25+,27+,28-,29+/m0/s1 |
| InChIKey | NNVVQONWWAGHBR-RMSQVJSMSA-N |
| XLogP | 3.38 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|