C27H32O7 — CID 132541427
[(4aS,5S,6aR,7S,10aS,11aS,11bS)-4a,10a-dihydroxy-4,4,7,11b-tetramethyl-6,9-dioxo-1,2,3,5,6a,7,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate (PubChem CID 132541427) has the molecular formula C27H32O7 and a molecular weight of 468.55 g/mol. Its IUPAC name is [(4aS,5S,6aR,7S,10aS,11aS,11bS)-4a,10a-dihydroxy-4,4,7,11b-tetramethyl-6,9-dioxo-1,2,3,5,6a,7,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate.
| Compound Name | [(4aS,5S,6aR,7S,10aS,11aS,11bS)-4a,10a-dihydroxy-4,4,7,11b-tetramethyl-6,9-dioxo-1,2,3,5,6a,7,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate |
|---|---|
| PubChem CID | 132541427 |
| Molecular Formula | C27H32O7 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | [(4aS,5S,6aR,7S,10aS,11aS,11bS)-4a,10a-dihydroxy-4,4,7,11b-tetramethyl-6,9-dioxo-1,2,3,5,6a,7,11,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate |
| SMILES | C[C@@H]1C2=CC(=O)O[C@@]2(O)C[C@H]2[C@@H]1C(=O)[C@@H](OC(=O)c1ccccc1)[C@]1(O)C(C)(C)CCC[C@@]21C |
| InChI | InChI=1S/C27H32O7/c1-15-17-13-19(28)34-26(17,31)14-18-20(15)21(29)22(33-23(30)16-9-6-5-7-10-16)27(32)24(2,3)11-8-12-25(18,27)4/h5-7,9-10,13,15,18,20,22,31-32H,8,11-12,14H2,1-4H3/t15-,18+,20-,22-,25+,26+,27+/m1/s1 |
| InChIKey | VBYIVCDJVGVKGF-BKEQTBOFSA-N |
| XLogP | 3.19 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |