C27H32O5 — CID 163104827
[(4aR,5R,6aS,7R,11aS,11bR)-4a-hydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,7,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate (PubChem CID 163104827) has the molecular formula C27H32O5 and a molecular weight of 436.55 g/mol. Its IUPAC name is [(4aR,5R,6aS,7R,11aS,11bR)-4a-hydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,7,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate.
| Compound Name | [(4aR,5R,6aS,7R,11aS,11bR)-4a-hydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,7,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate |
|---|---|
| PubChem CID | 163104827 |
| Molecular Formula | C27H32O5 |
| Molecular Weight | 436.55 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | [(4aR,5R,6aS,7R,11aS,11bR)-4a-hydroxy-4,4,7,11b-tetramethyl-9-oxo-1,2,3,5,6,6a,7,11a-octahydronaphtho[2,1-f][1]benzofuran-5-yl] benzoate |
| SMILES | C[C@H]1C2=CC(=O)OC2=C[C@@H]2[C@H]1C[C@@H](OC(=O)c1ccccc1)[C@@]1(O)C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C27H32O5/c1-16-18-13-22(32-24(29)17-9-6-5-7-10-17)27(30)25(2,3)11-8-12-26(27,4)20(18)15-21-19(16)14-23(28)31-21/h5-7,9-10,14-16,18,20,22,30H,8,11-13H2,1-4H3/t16-,18+,20-,22-,26-,27-/m1/s1 |
| InChIKey | LADWTXZKKXBSLF-IFTJFCESSA-N |
| XLogP | 4.81 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.55 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |