C20H28O3 — CID 164622416
(4aS,5R,6aS,7R,11aR,11bR)-5-hydroxy-4,4,7,11b-tetramethyl-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one (PubChem CID 164622416) has the molecular formula C20H28O3 and a molecular weight of 316.44 g/mol. Its IUPAC name is (4aS,5R,6aS,7R,11aR,11bR)-5-hydroxy-4,4,7,11b-tetramethyl-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one.
| Compound Name | (4aS,5R,6aS,7R,11aR,11bR)-5-hydroxy-4,4,7,11b-tetramethyl-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one |
|---|---|
| PubChem CID | 164622416 |
| Molecular Formula | C20H28O3 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.20 |
| IUPAC Name | (4aS,5R,6aS,7R,11aR,11bR)-5-hydroxy-4,4,7,11b-tetramethyl-2,3,4a,5,6,6a,7,11a-octahydro-1H-naphtho[2,1-f][1]benzofuran-9-one |
| SMILES | C[C@H]1C2=CC(=O)OC2=C[C@H]2[C@H]1C[C@@H](O)[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C20H28O3/c1-11-12-8-15(21)18-19(2,3)6-5-7-20(18,4)14(12)10-16-13(11)9-17(22)23-16/h9-12,14-15,18,21H,5-8H2,1-4H3/t11-,12+,14+,15-,18+,20-/m1/s1 |
| InChIKey | YMWGHDYAIJFGIV-YTMRHUQPSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |