C20H34O4 — CID 162800878
3a,6,6,9a-tetramethyl-3,3b,4,5,5a,7,8,9,9b,10,11,11a-dodecahydro-1H-naphtho[2,1-e][2]benzofuran-1,3,5-triol (PubChem CID 162800878) has the molecular formula C20H34O4 and a molecular weight of 338.49 g/mol. Its IUPAC name is 3a,6,6,9a-tetramethyl-3,3b,4,5,5a,7,8,9,9b,10,11,11a-dodecahydro-1H-naphtho[2,1-e][2]benzofuran-1,3,5-triol.
| Compound Name | 3a,6,6,9a-tetramethyl-3,3b,4,5,5a,7,8,9,9b,10,11,11a-dodecahydro-1H-naphtho[2,1-e][2]benzofuran-1,3,5-triol |
|---|---|
| PubChem CID | 162800878 |
| Molecular Formula | C20H34O4 |
| Molecular Weight | 338.49 g/mol |
| Exact Mass | 338.25 |
| IUPAC Name | 3a,6,6,9a-tetramethyl-3,3b,4,5,5a,7,8,9,9b,10,11,11a-dodecahydro-1H-naphtho[2,1-e][2]benzofuran-1,3,5-triol |
| SMILES | CC1(C)CCCC2(C)C3CCC4C(O)OC(O)C4(C)C3CC(O)C12 |
| InChI | InChI=1S/C20H34O4/c1-18(2)8-5-9-19(3)11-6-7-12-16(22)24-17(23)20(12,4)13(11)10-14(21)15(18)19/h11-17,21-23H,5-10H2,1-4H3 |
| InChIKey | ALAQIMOMIAOHGE-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |