C24H32O5 — CID 163014399
(1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl) 3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 163014399) has the molecular formula C24H32O5 and a molecular weight of 400.52 g/mol. Its IUPAC name is (1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl) 3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | (1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl) 3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 163014399 |
| Molecular Formula | C24H32O5 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (1-hydroxy-4a,8,8,8a-tetramethyl-1,3,3a,4,5,6,7,8b-octahydroindeno[1,2-c]furan-4-yl) 3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | CC1(C)CCCC2(C)C(OC(=O)C=Cc3ccc(O)cc3)C3COC(O)C3C12C |
| InChI | InChI=1S/C24H32O5/c1-22(2)12-5-13-23(3)20(17-14-28-21(27)19(17)24(22,23)4)29-18(26)11-8-15-6-9-16(25)10-7-15/h6-11,17,19-21,25,27H,5,12-14H2,1-4H3 |
| InChIKey | MEIBKHXXKNZYPZ-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|