C18H20O6 — CID 11393413
[(1R,4S,6R,7R,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate (PubChem CID 11393413) has the molecular formula C18H20O6 and a molecular weight of 332.35 g/mol. Its IUPAC name is [(1R,4S,6R,7R,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate.
| Compound Name | [(1R,4S,6R,7R,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 11393413 |
| Molecular Formula | C18H20O6 |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | [(1R,4S,6R,7R,11S)-4-hydroxy-2,10-dioxatricyclo[5.3.1.04,11]undecan-6-yl] (Z)-3-(4-hydroxyphenyl)prop-2-enoate |
| SMILES | O=C(/C=C\c1ccc(O)cc1)O[C@@H]1C[C@@]2(O)CO[C@H]3OCC[C@@H]1[C@H]32 |
| InChI | InChI=1S/C18H20O6/c19-12-4-1-11(2-5-12)3-6-15(20)24-14-9-18(21)10-23-17-16(18)13(14)7-8-22-17/h1-6,13-14,16-17,19,21H,7-10H2/b6-3-/t13-,14+,16+,17+,18+/m0/s1 |
| InChIKey | KPWKPPYUQLHPDZ-YKODBGQOSA-N |
| XLogP | 1.46 |
| TPSA | 85.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|