C25H26O10 — CID 123660845
1,3-dihydroxy-4-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid (PubChem CID 123660845) has the molecular formula C25H26O10 and a molecular weight of 486.47 g/mol. Its IUPAC name is 1,3-dihydroxy-4-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid.
| Compound Name | 1,3-dihydroxy-4-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 123660845 |
| Molecular Formula | C25H26O10 |
| Molecular Weight | 486.47 g/mol |
| Exact Mass | 486.15 |
| IUPAC Name | 1,3-dihydroxy-4-[1-hydroxy-3-(4-hydroxyphenyl)prop-2-enoxy]-5-[3-(4-hydroxyphenyl)prop-2-enoyloxy]cyclohexane-1-carboxylic acid |
| SMILES | O=C(C=Cc1ccc(O)cc1)OC1CC(O)(C(=O)O)CC(O)C1OC(O)C=Cc1ccc(O)cc1 |
| InChI | InChI=1S/C25H26O10/c26-17-7-1-15(2-8-17)5-11-21(29)34-20-14-25(33,24(31)32)13-19(28)23(20)35-22(30)12-6-16-3-9-18(27)10-4-16/h1-12,19-20,22-23,26-28,30,33H,13-14H2,(H,31,32) |
| InChIKey | AMNGZHXYXZAEAB-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 173.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.47 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|