C23H26O6 — CID 162866444
[(2S)-2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate (PubChem CID 162866444) has the molecular formula C23H26O6 and a molecular weight of 398.46 g/mol. Its IUPAC name is [(2S)-2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate.
| Compound Name | [(2S)-2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162866444 |
| Molecular Formula | C23H26O6 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | [(2S)-2-hydroxy-2-(2-hydroxy-4-methylphenyl)-3-(3-phenylprop-2-enoyloxy)propyl] 2-methylpropanoate |
| SMILES | Cc1ccc([C@@](O)(COC(=O)C=Cc2ccccc2)COC(=O)C(C)C)c(O)c1 |
| InChI | InChI=1S/C23H26O6/c1-16(2)22(26)29-15-23(27,19-11-9-17(3)13-20(19)24)14-28-21(25)12-10-18-7-5-4-6-8-18/h4-13,16,24,27H,14-15H2,1-3H3/t23-/m1/s1 |
| InChIKey | PSYOOPKAFUXOPK-HSZRJFAPSA-N |
| XLogP | 3.34 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|