C23H24O5 — CID 163187160
[5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate (PubChem CID 163187160) has the molecular formula C23H24O5 and a molecular weight of 380.44 g/mol. Its IUPAC name is [5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate.
| Compound Name | [5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 163187160 |
| Molecular Formula | C23H24O5 |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.16 |
| IUPAC Name | [5-methyl-2-[(2S)-2-[[(E)-3-phenylprop-2-enoyl]oxymethyl]oxiran-2-yl]phenyl] 2-methylpropanoate |
| SMILES | Cc1ccc([C@@]2(COC(=O)/C=C/c3ccccc3)CO2)c(OC(=O)C(C)C)c1 |
| InChI | InChI=1S/C23H24O5/c1-16(2)22(25)28-20-13-17(3)9-11-19(20)23(15-27-23)14-26-21(24)12-10-18-7-5-4-6-8-18/h4-13,16H,14-15H2,1-3H3/b12-10+/t23-/m1/s1 |
| InChIKey | UZOYGCFMXOUXPT-JBOJMBJVSA-N |
| XLogP | 4.04 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|