C17H24O4 — CID 162902108
[5-methyl-2-[2-(propan-2-yloxymethyl)oxiran-2-yl]phenyl] 2-methylpropanoate (PubChem CID 162902108) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is [5-methyl-2-[2-(propan-2-yloxymethyl)oxiran-2-yl]phenyl] 2-methylpropanoate.
| Compound Name | [5-methyl-2-[2-(propan-2-yloxymethyl)oxiran-2-yl]phenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 162902108 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | [5-methyl-2-[2-(propan-2-yloxymethyl)oxiran-2-yl]phenyl] 2-methylpropanoate |
| SMILES | Cc1ccc(C2(COC(C)C)CO2)c(OC(=O)C(C)C)c1 |
| InChI | InChI=1S/C17H24O4/c1-11(2)16(18)21-15-8-13(5)6-7-14(15)17(10-20-17)9-19-12(3)4/h6-8,11-12H,9-10H2,1-5H3 |
| InChIKey | VFSAFAGICVLPQC-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 48.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|