C19H26O5 — CID 38362523
[5-methyl-2-[(2R)-2-(2-methylpropanoyloxymethyl)oxiran-2-yl]phenyl] (2S)-2-methylbutanoate (PubChem CID 38362523) has the molecular formula C19H26O5 and a molecular weight of 334.41 g/mol. Its IUPAC name is [5-methyl-2-[(2R)-2-(2-methylpropanoyloxymethyl)oxiran-2-yl]phenyl] (2S)-2-methylbutanoate.
| Compound Name | [5-methyl-2-[(2R)-2-(2-methylpropanoyloxymethyl)oxiran-2-yl]phenyl] (2S)-2-methylbutanoate |
|---|---|
| PubChem CID | 38362523 |
| Molecular Formula | C19H26O5 |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.18 |
| IUPAC Name | [5-methyl-2-[(2R)-2-(2-methylpropanoyloxymethyl)oxiran-2-yl]phenyl] (2S)-2-methylbutanoate |
| SMILES | CC[C@H](C)C(=O)Oc1cc(C)ccc1[C@]1(COC(=O)C(C)C)CO1 |
| InChI | InChI=1S/C19H26O5/c1-6-14(5)18(21)24-16-9-13(4)7-8-15(16)19(11-23-19)10-22-17(20)12(2)3/h7-9,12,14H,6,10-11H2,1-5H3/t14-,19-/m0/s1 |
| InChIKey | CRVMDMUWJDBHRG-LIRRHRJNSA-N |
| XLogP | 3.37 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|