C16H20O5 — CID 14427473
[2-[2-(acetyloxymethyl)oxiran-2-yl]-5-methylphenyl] 2-methylpropanoate (PubChem CID 14427473) has the molecular formula C16H20O5 and a molecular weight of 292.33 g/mol. Its IUPAC name is [2-[2-(acetyloxymethyl)oxiran-2-yl]-5-methylphenyl] 2-methylpropanoate.
| Compound Name | [2-[2-(acetyloxymethyl)oxiran-2-yl]-5-methylphenyl] 2-methylpropanoate |
|---|---|
| PubChem CID | 14427473 |
| Molecular Formula | C16H20O5 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | [2-[2-(acetyloxymethyl)oxiran-2-yl]-5-methylphenyl] 2-methylpropanoate |
| SMILES | CC(=O)OCC1(c2ccc(C)cc2OC(=O)C(C)C)CO1 |
| InChI | InChI=1S/C16H20O5/c1-10(2)15(18)21-14-7-11(3)5-6-13(14)16(9-20-16)8-19-12(4)17/h5-7,10H,8-9H2,1-4H3 |
| InChIKey | JWLHEYGRDDWKPL-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|