About 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol
5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol (PubChem CID 162866825) has the molecular formula C17H20O5
and a molecular weight of 304.34 g/mol. Its IUPAC name is 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol.
Molecular Properties
| Compound Name | 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol |
| PubChem CID | 162866825 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol |
| SMILES | COc1ccc([C@@H](CO)[C@@H](OC)c2ccc(O)cc2)cc1O |
| InChI | InChI=1S/C17H20O5/c1-21-16-8-5-12(9-15(16)20)14(10-18)17(22-2)11-3-6-13(19)7-4-11/h3-9,14,17-20H,10H2,1-2H3/t14-,17+/m1/s1 |
| InChIKey | IOFCTFGFCBIVAN-PBHICJAKSA-N |
| XLogP | 2.57 |
| TPSA | 79.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol?
The IUPAC name of 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol (CID 162866825) is 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol.
What is the SMILES notation for 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol?
The canonical SMILES for 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol is COc1ccc([C@@H](CO)[C@@H](OC)c2ccc(O)cc2)cc1O.
What is the InChIKey of 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol?
The InChIKey is IOFCTFGFCBIVAN-PBHICJAKSA-N. The full InChI is InChI=1S/C17H20O5/c1-21-16-8-5-12(9-15(16)20)14(10-18)17(22-2)11-3-6-13(19)7-4-11/h3-9,14,17-20H,10H2,1-2H3/t14-,17+/m1/s1.
What are the key properties of 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol?
5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol has a molecular weight of 304.34 g/mol, XLogP of 2.57, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(1R,2S)-3-hydroxy-1-(4-hydroxyphenyl)-1-methoxypropan-2-yl]-2-methoxyphenol is sourced from PubChem (CID 162866825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).