C13H22NO4+ — CID 7055164
2,2-dimethoxyethyl-[(1S)-1-(3-hydroxy-4-methoxyphenyl)ethyl]azanium (PubChem CID 7055164) has the molecular formula C13H22NO4+ and a molecular weight of 256.32 g/mol. Its IUPAC name is 2,2-dimethoxyethyl-[(1S)-1-(3-hydroxy-4-methoxyphenyl)ethyl]azanium.
| Compound Name | 2,2-dimethoxyethyl-[(1S)-1-(3-hydroxy-4-methoxyphenyl)ethyl]azanium |
|---|---|
| PubChem CID | 7055164 |
| Molecular Formula | C13H22NO4+ |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2,2-dimethoxyethyl-[(1S)-1-(3-hydroxy-4-methoxyphenyl)ethyl]azanium |
| SMILES | COc1ccc([C@H](C)[NH2+]CC(OC)OC)cc1O |
| InChI | InChI=1S/C13H21NO4/c1-9(14-8-13(17-3)18-4)10-5-6-12(16-2)11(15)7-10/h5-7,9,13-15H,8H2,1-4H3/p+1/t9-/m0/s1 |
| InChIKey | HBZSDJIHYFXWII-VIFPVBQESA-O |
| XLogP | 0.64 |
| TPSA | 64.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|