C26H38O2 — CID 162867768
(1R,3aS,4S,7aR)-4-[2-(5-hydroxy-2-methylphenyl)ethyl]-7a-methyl-1-[(2R)-5-methylhex-3-en-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one (PubChem CID 162867768) has the molecular formula C26H38O2 and a molecular weight of 382.59 g/mol. Its IUPAC name is (1R,3aS,4S,7aR)-4-[2-(5-hydroxy-2-methylphenyl)ethyl]-7a-methyl-1-[(2R)-5-methylhex-3-en-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one.
| Compound Name | (1R,3aS,4S,7aR)-4-[2-(5-hydroxy-2-methylphenyl)ethyl]-7a-methyl-1-[(2R)-5-methylhex-3-en-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
|---|---|
| PubChem CID | 162867768 |
| Molecular Formula | C26H38O2 |
| Molecular Weight | 382.59 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | (1R,3aS,4S,7aR)-4-[2-(5-hydroxy-2-methylphenyl)ethyl]-7a-methyl-1-[(2R)-5-methylhex-3-en-2-yl]-2,3,3a,4,6,7-hexahydro-1H-inden-5-one |
| SMILES | Cc1ccc(O)cc1CC[C@@H]1C(=O)CC[C@]2(C)[C@@H]([C@H](C)C=CC(C)C)CC[C@@H]12 |
| InChI | InChI=1S/C26H38O2/c1-17(2)6-7-19(4)23-12-13-24-22(25(28)14-15-26(23,24)5)11-9-20-16-21(27)10-8-18(20)3/h6-8,10,16-17,19,22-24,27H,9,11-15H2,1-5H3/t19-,22+,23-,24+,26-/m1/s1 |
| InChIKey | RRMCPFHCUFBINS-YRPZDVKUSA-N |
| XLogP | 6.49 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.59 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|