C32H48O4S — CID 24984563
3-[(3R,3aR,5aS,6S,9aR,9bS)-3a-methyl-3-[(E,2S)-6-methylhept-3-en-2-yl]-7-oxo-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-6-yl]propyl 4-methylbenzenesulfonate (PubChem CID 24984563) has the molecular formula C32H48O4S and a molecular weight of 528.80 g/mol. Its IUPAC name is 3-[(3R,3aR,5aS,6S,9aR,9bS)-3a-methyl-3-[(E,2S)-6-methylhept-3-en-2-yl]-7-oxo-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-6-yl]propyl 4-methylbenzenesulfonate.
| Compound Name | 3-[(3R,3aR,5aS,6S,9aR,9bS)-3a-methyl-3-[(E,2S)-6-methylhept-3-en-2-yl]-7-oxo-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-6-yl]propyl 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 24984563 |
| Molecular Formula | C32H48O4S |
| Molecular Weight | 528.80 g/mol |
| Exact Mass | 528.33 |
| IUPAC Name | 3-[(3R,3aR,5aS,6S,9aR,9bS)-3a-methyl-3-[(E,2S)-6-methylhept-3-en-2-yl]-7-oxo-2,3,4,5,5a,6,8,9,9a,9b-decahydro-1H-cyclopenta[a]naphthalen-6-yl]propyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCCC[C@@H]2C(=O)CC[C@@H]3[C@@H]2CC[C@]2(C)[C@@H]([C@@H](C)/C=C/CC(C)C)CC[C@@H]32)cc1 |
| InChI | InChI=1S/C32H48O4S/c1-22(2)8-6-9-24(4)29-16-17-30-27-15-18-31(33)28(26(27)19-20-32(29,30)5)10-7-21-36-37(34,35)25-13-11-23(3)12-14-25/h6,9,11-14,22,24,26-30H,7-8,10,15-21H2,1-5H3/b9-6+/t24-,26-,27+,28-,29+,30-,32+/m0/s1 |
| InChIKey | YUKFDHYKGYHZFN-FFGGPHKZSA-N |
| XLogP | 7.76 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.80 |
| LogP ≤ 5 | 7.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|