C25H36O9 — CID 162869643
methyl 5-butan-2-yloxy-4-(2,3-dimethyloxirane-2-carbonyl)oxy-10-(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-6-carboxylate (PubChem CID 162869643) has the molecular formula C25H36O9 and a molecular weight of 480.55 g/mol. Its IUPAC name is methyl 5-butan-2-yloxy-4-(2,3-dimethyloxirane-2-carbonyl)oxy-10-(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-6-carboxylate.
| Compound Name | methyl 5-butan-2-yloxy-4-(2,3-dimethyloxirane-2-carbonyl)oxy-10-(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-6-carboxylate |
|---|---|
| PubChem CID | 162869643 |
| Molecular Formula | C25H36O9 |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | methyl 5-butan-2-yloxy-4-(2,3-dimethyloxirane-2-carbonyl)oxy-10-(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,10,11,11a-octahydrocyclodeca[b]furan-6-carboxylate |
| SMILES | C=C1C(=O)OC2CC(CO)CCC=C(C(=O)OC)C(OC(C)CC)C(OC(=O)C3(C)OC3C)C12 |
| InChI | InChI=1S/C25H36O9/c1-7-13(2)31-20-17(23(28)30-6)10-8-9-16(12-26)11-18-19(14(3)22(27)32-18)21(20)33-24(29)25(5)15(4)34-25/h10,13,15-16,18-21,26H,3,7-9,11-12H2,1-2,4-6H3 |
| InChIKey | RNWVAMAILZZWBT-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 120.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|