C23H26O11 — CID 176516672
methyl (5E,7E)-4-(acetyloxymethyl)-10-(2,3-dimethyloxirane-2-carbonyl)oxy-9-hydroxy-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-5,7-diene-8-carboxylate (PubChem CID 176516672) has the molecular formula C23H26O11 and a molecular weight of 478.45 g/mol. Its IUPAC name is methyl (5E,7E)-4-(acetyloxymethyl)-10-(2,3-dimethyloxirane-2-carbonyl)oxy-9-hydroxy-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-5,7-diene-8-carboxylate.
| Compound Name | methyl (5E,7E)-4-(acetyloxymethyl)-10-(2,3-dimethyloxirane-2-carbonyl)oxy-9-hydroxy-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-5,7-diene-8-carboxylate |
|---|---|
| PubChem CID | 176516672 |
| Molecular Formula | C23H26O11 |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | methyl (5E,7E)-4-(acetyloxymethyl)-10-(2,3-dimethyloxirane-2-carbonyl)oxy-9-hydroxy-12-methylidene-13-oxo-3,14-dioxatricyclo[9.3.0.02,4]tetradeca-5,7-diene-8-carboxylate |
| SMILES | C=C1C(=O)OC2C1C(OC(=O)C1(C)OC1C)C(O)/C(C(=O)OC)=C\C=C\C1(COC(C)=O)OC21 |
| InChI | InChI=1S/C23H26O11/c1-10-14-16(32-21(28)22(4)11(2)33-22)15(25)13(20(27)29-5)7-6-8-23(9-30-12(3)24)18(34-23)17(14)31-19(10)26/h6-8,11,14-18,25H,1,9H2,2-5H3/b8-6+,13-7+ |
| InChIKey | BZBNXWIJKLZMQX-NQSFVOBFSA-N |
| XLogP | -0.10 |
| TPSA | 150.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|