C22H32O7 — CID 162870073
methyl 9-acetyloxy-10-(butanoyloxymethyl)-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate (PubChem CID 162870073) has the molecular formula C22H32O7 and a molecular weight of 408.49 g/mol. Its IUPAC name is methyl 9-acetyloxy-10-(butanoyloxymethyl)-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate.
| Compound Name | methyl 9-acetyloxy-10-(butanoyloxymethyl)-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate |
|---|---|
| PubChem CID | 162870073 |
| Molecular Formula | C22H32O7 |
| Molecular Weight | 408.49 g/mol |
| Exact Mass | 408.21 |
| IUPAC Name | methyl 9-acetyloxy-10-(butanoyloxymethyl)-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate |
| SMILES | C=C(C)C1CC=C(C(=O)OC)CCC2OC2(COC(=O)CCC)C(OC(C)=O)C1 |
| InChI | InChI=1S/C22H32O7/c1-6-7-20(24)27-13-22-18(29-22)11-10-16(21(25)26-5)8-9-17(14(2)3)12-19(22)28-15(4)23/h8,17-19H,2,6-7,9-13H2,1,3-5H3 |
| InChIKey | NDXKGBCIWWGTJJ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.49 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|