C26H40O7 — CID 163013029
methyl (1R,4Z,7S,9S,10S)-9-[(2R)-2-methylbutanoyl]oxy-10-[[(2R)-2-methylbutanoyl]oxymethyl]-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate (PubChem CID 163013029) has the molecular formula C26H40O7 and a molecular weight of 464.60 g/mol. Its IUPAC name is methyl (1R,4Z,7S,9S,10S)-9-[(2R)-2-methylbutanoyl]oxy-10-[[(2R)-2-methylbutanoyl]oxymethyl]-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate.
| Compound Name | methyl (1R,4Z,7S,9S,10S)-9-[(2R)-2-methylbutanoyl]oxy-10-[[(2R)-2-methylbutanoyl]oxymethyl]-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate |
|---|---|
| PubChem CID | 163013029 |
| Molecular Formula | C26H40O7 |
| Molecular Weight | 464.60 g/mol |
| Exact Mass | 464.28 |
| IUPAC Name | methyl (1R,4Z,7S,9S,10S)-9-[(2R)-2-methylbutanoyl]oxy-10-[[(2R)-2-methylbutanoyl]oxymethyl]-7-prop-1-en-2-yl-11-oxabicyclo[8.1.0]undec-4-ene-4-carboxylate |
| SMILES | C=C(C)[C@H]1C/C=C(\C(=O)OC)CC[C@H]2O[C@]2(COC(=O)[C@H](C)CC)[C@@H](OC(=O)[C@H](C)CC)C1 |
| InChI | InChI=1S/C26H40O7/c1-8-17(5)23(27)31-15-26-21(33-26)13-12-19(25(29)30-7)10-11-20(16(3)4)14-22(26)32-24(28)18(6)9-2/h10,17-18,20-22H,3,8-9,11-15H2,1-2,4-7H3/b19-10-/t17-,18-,20+,21-,22+,26+/m1/s1 |
| InChIKey | OQZKLRWWSFIKGA-UYVQBUFYSA-N |
| XLogP | 4.54 |
| TPSA | 91.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.60 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|