C21H36O2 — CID 144949841
[(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-butan-2-yl-4-methylhexanoate (PubChem CID 144949841) has the molecular formula C21H36O2 and a molecular weight of 320.52 g/mol. Its IUPAC name is [(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-butan-2-yl-4-methylhexanoate.
| Compound Name | [(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-butan-2-yl-4-methylhexanoate |
|---|---|
| PubChem CID | 144949841 |
| Molecular Formula | C21H36O2 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.27 |
| IUPAC Name | [(1R,5S)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-butan-2-yl-4-methylhexanoate |
| SMILES | C=C(C)[C@H]1CC=C(C)[C@H](OC(=O)C(CC(C)CC)C(C)CC)C1 |
| InChI | InChI=1S/C21H36O2/c1-8-15(5)12-19(16(6)9-2)21(22)23-20-13-18(14(3)4)11-10-17(20)7/h10,15-16,18-20H,3,8-9,11-13H2,1-2,4-7H3/t15?,16?,18-,19?,20+/m0/s1 |
| InChIKey | ZQFVLKUDIFCGHZ-WANGQUDJSA-N |
| XLogP | 5.93 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|