C18H22O2 — CID 3085725
[(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-phenylacetate (PubChem CID 3085725) has the molecular formula C18H22O2 and a molecular weight of 270.37 g/mol. Its IUPAC name is [(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-phenylacetate.
| Compound Name | [(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-phenylacetate |
|---|---|
| PubChem CID | 3085725 |
| Molecular Formula | C18H22O2 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.16 |
| IUPAC Name | [(1R,5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl] 2-phenylacetate |
| SMILES | C=C(C)[C@@H]1CC=C(C)[C@H](OC(=O)Cc2ccccc2)C1 |
| InChI | InChI=1S/C18H22O2/c1-13(2)16-10-9-14(3)17(12-16)20-18(19)11-15-7-5-4-6-8-15/h4-9,16-17H,1,10-12H2,2-3H3/t16-,17-/m1/s1 |
| InChIKey | KDKVSYFQKDKENM-IAGOWNOFSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|