C22H32O6 — CID 162870362
methyl 5-(2-formyl-4-hydroxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-(formyloxymethyl)pent-2-enoate (PubChem CID 162870362) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is methyl 5-(2-formyl-4-hydroxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-(formyloxymethyl)pent-2-enoate.
| Compound Name | methyl 5-(2-formyl-4-hydroxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-(formyloxymethyl)pent-2-enoate |
|---|---|
| PubChem CID | 162870362 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl 5-(2-formyl-4-hydroxy-5,5,8a-trimethyl-1,4,4a,6,7,8-hexahydronaphthalen-1-yl)-3-(formyloxymethyl)pent-2-enoate |
| SMILES | COC(=O)C=C(CCC1C(C=O)=CC(O)C2C(C)(C)CCCC12C)COC=O |
| InChI | InChI=1S/C22H32O6/c1-21(2)8-5-9-22(3)17(16(12-23)11-18(25)20(21)22)7-6-15(13-28-14-24)10-19(26)27-4/h10-12,14,17-18,20,25H,5-9,13H2,1-4H3 |
| InChIKey | WNGUATLTENRAIQ-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|