C23H32O6 — CID 162974095
methyl 3-(acetyloxymethyl)-4-(2-hydroxy-5,5,8a-trimethyl-4-oxo-2,4a,6,7,8,8b-hexahydro-1H-cyclobuta[a]naphthalen-1-yl)but-2-enoate (PubChem CID 162974095) has the molecular formula C23H32O6 and a molecular weight of 404.50 g/mol. Its IUPAC name is methyl 3-(acetyloxymethyl)-4-(2-hydroxy-5,5,8a-trimethyl-4-oxo-2,4a,6,7,8,8b-hexahydro-1H-cyclobuta[a]naphthalen-1-yl)but-2-enoate.
| Compound Name | methyl 3-(acetyloxymethyl)-4-(2-hydroxy-5,5,8a-trimethyl-4-oxo-2,4a,6,7,8,8b-hexahydro-1H-cyclobuta[a]naphthalen-1-yl)but-2-enoate |
|---|---|
| PubChem CID | 162974095 |
| Molecular Formula | C23H32O6 |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | methyl 3-(acetyloxymethyl)-4-(2-hydroxy-5,5,8a-trimethyl-4-oxo-2,4a,6,7,8,8b-hexahydro-1H-cyclobuta[a]naphthalen-1-yl)but-2-enoate |
| SMILES | COC(=O)C=C(COC(C)=O)CC1C(O)C2=CC(=O)C3C(C)(C)CCCC3(C)C21 |
| InChI | InChI=1S/C23H32O6/c1-13(24)29-12-14(10-18(26)28-5)9-15-19-16(20(15)27)11-17(25)21-22(2,3)7-6-8-23(19,21)4/h10-11,15,19-21,27H,6-9,12H2,1-5H3 |
| InChIKey | BTGFPAHDTFCJGS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|