C26H40O6 — CID 23757246
[(Z)-5-(3-acetyloxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-(acetyloxymethyl)pent-2-enyl] acetate (PubChem CID 23757246) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is [(Z)-5-(3-acetyloxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-(acetyloxymethyl)pent-2-enyl] acetate.
| Compound Name | [(Z)-5-(3-acetyloxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-(acetyloxymethyl)pent-2-enyl] acetate |
|---|---|
| PubChem CID | 23757246 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [(Z)-5-(3-acetyloxy-5,5,8a-trimethyl-2-methylidene-3,4,4a,6,7,8-hexahydro-1H-naphthalen-1-yl)-3-(acetyloxymethyl)pent-2-enyl] acetate |
| SMILES | C=C1C(OC(C)=O)CC2C(C)(C)CCCC2(C)C1CC/C(=C/COC(C)=O)COC(C)=O |
| InChI | InChI=1S/C26H40O6/c1-17-22(10-9-21(16-31-19(3)28)11-14-30-18(2)27)26(7)13-8-12-25(5,6)24(26)15-23(17)32-20(4)29/h11,22-24H,1,8-10,12-16H2,2-7H3/b21-11- |
| InChIKey | ODZFMXHXLJBSOC-NHDPSOOVSA-N |
| XLogP | 5.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|