C26H42O8 — CID 162923222
[(E)-5-[(1S,2R,4aR,5R,6R,7R,8aR)-5-acetyloxy-6,7-dihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enyl] acetate (PubChem CID 162923222) has the molecular formula C26H42O8 and a molecular weight of 482.61 g/mol. Its IUPAC name is [(E)-5-[(1S,2R,4aR,5R,6R,7R,8aR)-5-acetyloxy-6,7-dihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enyl] acetate.
| Compound Name | [(E)-5-[(1S,2R,4aR,5R,6R,7R,8aR)-5-acetyloxy-6,7-dihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enyl] acetate |
|---|---|
| PubChem CID | 162923222 |
| Molecular Formula | C26H42O8 |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.29 |
| IUPAC Name | [(E)-5-[(1S,2R,4aR,5R,6R,7R,8aR)-5-acetyloxy-6,7-dihydroxy-1,2,4a,5-tetramethyl-3,4,6,7,8,8a-hexahydro-2H-naphthalen-1-yl]-3-(acetyloxymethyl)pent-2-enyl] acetate |
| SMILES | CC(=O)OC/C=C(\CC[C@@]1(C)[C@H](C)CC[C@]2(C)[C@@H]1C[C@@H](O)[C@@H](O)[C@]2(C)OC(C)=O)COC(C)=O |
| InChI | InChI=1S/C26H42O8/c1-16-8-12-25(6)22(14-21(30)23(31)26(25,7)34-19(4)29)24(16,5)11-9-20(15-33-18(3)28)10-13-32-17(2)27/h10,16,21-23,30-31H,8-9,11-15H2,1-7H3/b20-10+/t16-,21-,22-,23-,24+,25-,26+/m1/s1 |
| InChIKey | KWPQTKJGULBOOD-SZHMKOLHSA-N |
| XLogP | 3.33 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|