C26H40O6 — CID 163034449
[3-(acetyloxymethyl)-5-[2-(acetyloxymethyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pent-2-enyl] acetate (PubChem CID 163034449) has the molecular formula C26H40O6 and a molecular weight of 448.60 g/mol. Its IUPAC name is [3-(acetyloxymethyl)-5-[2-(acetyloxymethyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pent-2-enyl] acetate.
| Compound Name | [3-(acetyloxymethyl)-5-[2-(acetyloxymethyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pent-2-enyl] acetate |
|---|---|
| PubChem CID | 163034449 |
| Molecular Formula | C26H40O6 |
| Molecular Weight | 448.60 g/mol |
| Exact Mass | 448.28 |
| IUPAC Name | [3-(acetyloxymethyl)-5-[2-(acetyloxymethyl)-1,4a,5-trimethyl-2,3,4,7,8,8a-hexahydronaphthalen-1-yl]pent-2-enyl] acetate |
| SMILES | CC(=O)OCC=C(CCC1(C)C(COC(C)=O)CCC2(C)C(C)=CCCC21)COC(C)=O |
| InChI | InChI=1S/C26H40O6/c1-18-8-7-9-24-25(18,5)14-11-23(17-32-21(4)29)26(24,6)13-10-22(16-31-20(3)28)12-15-30-19(2)27/h8,12,23-24H,7,9-11,13-17H2,1-6H3 |
| InChIKey | VZYHKGPSZOJCQH-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.60 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|